C15H18N4O2S — CID 126468341
4-(1-methylsulfonylpiperidin-3-yl)-5-pyridin-4-ylpyrimidine (PubChem CID 126468341) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-(1-methylsulfonylpiperidin-3-yl)-5-pyridin-4-ylpyrimidine.
| Compound Name | 4-(1-methylsulfonylpiperidin-3-yl)-5-pyridin-4-ylpyrimidine |
|---|---|
| PubChem CID | 126468341 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-(1-methylsulfonylpiperidin-3-yl)-5-pyridin-4-ylpyrimidine |
| SMILES | CS(=O)(=O)N1CCCC(c2ncncc2-c2ccncc2)C1 |
| InChI | InChI=1S/C15H18N4O2S/c1-22(20,21)19-8-2-3-13(10-19)15-14(9-17-11-18-15)12-4-6-16-7-5-12/h4-7,9,11,13H,2-3,8,10H2,1H3 |
| InChIKey | LJTFXMAYOVCHDT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |