C12H22O2 — CID 12647338
1-(3-tert-butyl-3-methyloxiran-2-yl)-2,2-dimethylpropan-1-one (PubChem CID 12647338) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(3-tert-butyl-3-methyloxiran-2-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(3-tert-butyl-3-methyloxiran-2-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 12647338 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 1-(3-tert-butyl-3-methyloxiran-2-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)C1OC1(C)C(C)(C)C |
| InChI | InChI=1S/C12H22O2/c1-10(2,3)8(13)9-12(7,14-9)11(4,5)6/h9H,1-7H3 |
| InChIKey | MOMZZYCVOOJISA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|