C21H20N6O2 — CID 126473544
[4-[3-(4-aminophenyl)imidazo[1,2-a]pyrazin-8-yl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 126473544) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is [4-[3-(4-aminophenyl)imidazo[1,2-a]pyrazin-8-yl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[3-(4-aminophenyl)imidazo[1,2-a]pyrazin-8-yl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 126473544 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [4-[3-(4-aminophenyl)imidazo[1,2-a]pyrazin-8-yl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | Nc1ccc(-c2cnc3c(N4CCN(C(=O)c5ccco5)CC4)nccn23)cc1 |
| InChI | InChI=1S/C21H20N6O2/c22-16-5-3-15(4-6-16)17-14-24-20-19(23-7-8-27(17)20)25-9-11-26(12-10-25)21(28)18-2-1-13-29-18/h1-8,13-14H,9-12,22H2 |
| InChIKey | PYJCHRZNCOBLEF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|