About N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine
N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 126473631) has the molecular formula C19H18N4O
and a molecular weight of 318.38 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 126473631 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1ccc(CNc2ccnc3c(-c4ccoc4)cnn23)c(C)c1 |
| InChI | InChI=1S/C19H18N4O/c1-13-3-4-15(14(2)9-13)10-21-18-5-7-20-19-17(11-22-23(18)19)16-6-8-24-12-16/h3-9,11-12,21H,10H2,1-2H3 |
| InChIKey | AIRPWRBYLNSOBB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine (CID 126473631) is N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine is Cc1ccc(CNc2ccnc3c(-c4ccoc4)cnn23)c(C)c1.
What is the InChIKey of N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is AIRPWRBYLNSOBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O/c1-13-3-4-15(14(2)9-13)10-21-18-5-7-20-19-17(11-22-23(18)19)16-6-8-24-12-16/h3-9,11-12,21H,10H2,1-2H3.
What are the key properties of N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 318.38 g/mol, XLogP of 4.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dimethylphenyl)methyl]-3-(furan-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 126473631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).