About 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid
5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid (PubChem CID 166272427) has the molecular formula C12H12N6O2
and a molecular weight of 272.27 g/mol. Its IUPAC name is 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid |
| PubChem CID | 166272427 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid |
| SMILES | Cc1cnn2c(NCc3cc(C(=O)O)n[nH]3)ccnc12 |
| InChI | InChI=1S/C12H12N6O2/c1-7-5-15-18-10(2-3-13-11(7)18)14-6-8-4-9(12(19)20)17-16-8/h2-5,14H,6H2,1H3,(H,16,17)(H,19,20) |
| InChIKey | XNMXRGVOTQPMKE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid?
The IUPAC name of 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid (CID 166272427) is 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid.
What is the SMILES notation for 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid?
The canonical SMILES for 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid is Cc1cnn2c(NCc3cc(C(=O)O)n[nH]3)ccnc12.
What is the InChIKey of 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid?
The InChIKey is XNMXRGVOTQPMKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N6O2/c1-7-5-15-18-10(2-3-13-11(7)18)14-6-8-4-9(12(19)20)17-16-8/h2-5,14H,6H2,1H3,(H,16,17)(H,19,20).
What are the key properties of 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid?
5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid has a molecular weight of 272.27 g/mol, XLogP of 1.07, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(3-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]methyl]-1H-pyrazole-3-carboxylic acid is sourced from PubChem (CID 166272427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).