C13H15N5 — CID 143406596
3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 143406596) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is 3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 143406596 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-methyl-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C=C/C=C(/CNc1ccnc2c(C)cnn12)N=C |
| InChI | InChI=1S/C13H15N5/c1-4-5-11(14-3)9-16-12-6-7-15-13-10(2)8-17-18(12)13/h4-8,16H,1,3,9H2,2H3/b11-5- |
| InChIKey | SPTLZPBSWBNDDO-WZUFQYTHSA-N |
| XLogP | 2.22 |
| TPSA | 54.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|