About 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol
2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol (PubChem CID 126473750) has the molecular formula C18H21N5O
and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol |
| PubChem CID | 126473750 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(c2ncc(-c3ccccc3)n3ccnc23)CC1 |
| InChI | InChI=1S/C18H21N5O/c24-13-12-21-8-10-22(11-9-21)17-18-19-6-7-23(18)16(14-20-17)15-4-2-1-3-5-15/h1-7,14,24H,8-13H2 |
| InChIKey | ZNKSDOUSNMVHMP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol?
The IUPAC name of 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol (CID 126473750) is 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol.
What is the SMILES notation for 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol?
The canonical SMILES for 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol is OCCN1CCN(c2ncc(-c3ccccc3)n3ccnc23)CC1.
What is the InChIKey of 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol?
The InChIKey is ZNKSDOUSNMVHMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N5O/c24-13-12-21-8-10-22(11-9-21)17-18-19-6-7-23(18)16(14-20-17)15-4-2-1-3-5-15/h1-7,14,24H,8-13H2.
What are the key properties of 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol?
2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol has a molecular weight of 323.40 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5-phenylimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]ethanol is sourced from PubChem (CID 126473750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).