C18H22N6O — CID 126475538
2-[4-[5-(4-aminophenyl)imidazo[1,2-a]pyrazin-8-yl]piperazin-1-yl]ethanol (PubChem CID 126475538) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 2-[4-[5-(4-aminophenyl)imidazo[1,2-a]pyrazin-8-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[5-(4-aminophenyl)imidazo[1,2-a]pyrazin-8-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 126475538 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-[4-[5-(4-aminophenyl)imidazo[1,2-a]pyrazin-8-yl]piperazin-1-yl]ethanol |
| SMILES | Nc1ccc(-c2cnc(N3CCN(CCO)CC3)c3nccn23)cc1 |
| InChI | InChI=1S/C18H22N6O/c19-15-3-1-14(2-4-15)16-13-21-17(18-20-5-6-24(16)18)23-9-7-22(8-10-23)11-12-25/h1-6,13,25H,7-12,19H2 |
| InChIKey | TVNRMUVKEZCEAT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|