C21H25F3N4O3 — CID 126473875
[2-(2-methoxyethylamino)-6-[3-(trifluoromethoxy)phenyl]-3-pyridinyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 126473875) has the molecular formula C21H25F3N4O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-6-[3-(trifluoromethoxy)phenyl]-3-pyridinyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [2-(2-methoxyethylamino)-6-[3-(trifluoromethoxy)phenyl]-3-pyridinyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 126473875 |
| Molecular Formula | C21H25F3N4O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | [2-(2-methoxyethylamino)-6-[3-(trifluoromethoxy)phenyl]-3-pyridinyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | COCCNc1nc(-c2cccc(OC(F)(F)F)c2)ccc1C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C21H25F3N4O3/c1-27-9-11-28(12-10-27)20(29)17-6-7-18(26-19(17)25-8-13-30-2)15-4-3-5-16(14-15)31-21(22,23)24/h3-7,14H,8-13H2,1-2H3,(H,25,26) |
| InChIKey | WWMGSTHROZBUJE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|