C20H23F3N4O4 — CID 126474165
N-(2-acetamidoethyl)-2-(2-methoxyethylamino)-6-[3-(trifluoromethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 126474165) has the molecular formula C20H23F3N4O4 and a molecular weight of 440.42 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-(2-methoxyethylamino)-6-[3-(trifluoromethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-2-(2-methoxyethylamino)-6-[3-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126474165 |
| Molecular Formula | C20H23F3N4O4 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-(2-acetamidoethyl)-2-(2-methoxyethylamino)-6-[3-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | COCCNc1nc(-c2cccc(OC(F)(F)F)c2)ccc1C(=O)NCCNC(C)=O |
| InChI | InChI=1S/C20H23F3N4O4/c1-13(28)24-8-9-26-19(29)16-6-7-17(27-18(16)25-10-11-30-2)14-4-3-5-15(12-14)31-20(21,22)23/h3-7,12H,8-11H2,1-2H3,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | WNXKCWXOYOJORC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|