C30H32N4O4 — CID 25218733
6-[benzyl(ethyl)amino]-2-(2,6-dimethoxy-3-pyridinyl)-N-(2-phenoxyethyl)pyridine-3-carboxamide (PubChem CID 25218733) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is 6-[benzyl(ethyl)amino]-2-(2,6-dimethoxy-3-pyridinyl)-N-(2-phenoxyethyl)pyridine-3-carboxamide.
| Compound Name | 6-[benzyl(ethyl)amino]-2-(2,6-dimethoxy-3-pyridinyl)-N-(2-phenoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25218733 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 6-[benzyl(ethyl)amino]-2-(2,6-dimethoxy-3-pyridinyl)-N-(2-phenoxyethyl)pyridine-3-carboxamide |
| SMILES | CCN(Cc1ccccc1)c1ccc(C(=O)NCCOc2ccccc2)c(-c2ccc(OC)nc2OC)n1 |
| InChI | InChI=1S/C30H32N4O4/c1-4-34(21-22-11-7-5-8-12-22)26-17-15-24(29(35)31-19-20-38-23-13-9-6-10-14-23)28(32-26)25-16-18-27(36-2)33-30(25)37-3/h5-18H,4,19-21H2,1-3H3,(H,31,35) |
| InChIKey | DPISCHMOAFKKEG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|