C16H11ClN4S — CID 126474756
N-(4-chlorophenyl)-3-thiophen-3-ylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 126474756) has the molecular formula C16H11ClN4S and a molecular weight of 326.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-thiophen-3-ylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-(4-chlorophenyl)-3-thiophen-3-ylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 126474756 |
| Molecular Formula | C16H11ClN4S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-(4-chlorophenyl)-3-thiophen-3-ylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | Clc1ccc(Nc2nccn3c(-c4ccsc4)cnc23)cc1 |
| InChI | InChI=1S/C16H11ClN4S/c17-12-1-3-13(4-2-12)20-15-16-19-9-14(11-5-8-22-10-11)21(16)7-6-18-15/h1-10H,(H,18,20) |
| InChIKey | IDSYWBZMVMMUIL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |