C24H26N4O3 — CID 126475213
N-(3-phenylpropyl)-5-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 126475213) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-(3-phenylpropyl)-5-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-(3-phenylpropyl)-5-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 126475213 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-(3-phenylpropyl)-5-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | COc1cc(-c2cnc(NCCCc3ccccc3)c3nccn23)cc(OC)c1OC |
| InChI | InChI=1S/C24H26N4O3/c1-29-20-14-18(15-21(30-2)22(20)31-3)19-16-27-23(24-26-12-13-28(19)24)25-11-7-10-17-8-5-4-6-9-17/h4-6,8-9,12-16H,7,10-11H2,1-3H3,(H,25,27) |
| InChIKey | XYJGRCOYMGUFQF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|