C23H32N2O7 — CID 126476702
3-cyclopentyl-1-[4-[2-(4-methoxyphenyl)-2-oxoethyl]piperazin-1-yl]propan-1-one;oxalic acid (PubChem CID 126476702) has the molecular formula C23H32N2O7 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-cyclopentyl-1-[4-[2-(4-methoxyphenyl)-2-oxoethyl]piperazin-1-yl]propan-1-one;oxalic acid.
| Compound Name | 3-cyclopentyl-1-[4-[2-(4-methoxyphenyl)-2-oxoethyl]piperazin-1-yl]propan-1-one;oxalic acid |
|---|---|
| PubChem CID | 126476702 |
| Molecular Formula | C23H32N2O7 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 3-cyclopentyl-1-[4-[2-(4-methoxyphenyl)-2-oxoethyl]piperazin-1-yl]propan-1-one;oxalic acid |
| SMILES | COc1ccc(C(=O)CN2CCN(C(=O)CCC3CCCC3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H30N2O3.C2H2O4/c1-26-19-9-7-18(8-10-19)20(24)16-22-12-14-23(15-13-22)21(25)11-6-17-4-2-3-5-17;3-1(4)2(5)6/h7-10,17H,2-6,11-16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JXNQSESQBNMHRW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|