C20H24Cl2N2O3 — CID 126476891
[4-[3-(3-chlorophenoxy)-2-hydroxypropyl]piperazin-1-yl]-phenylmethanone;hydrochloride (PubChem CID 126476891) has the molecular formula C20H24Cl2N2O3 and a molecular weight of 411.33 g/mol. Its IUPAC name is [4-[3-(3-chlorophenoxy)-2-hydroxypropyl]piperazin-1-yl]-phenylmethanone;hydrochloride.
| Compound Name | [4-[3-(3-chlorophenoxy)-2-hydroxypropyl]piperazin-1-yl]-phenylmethanone;hydrochloride |
|---|---|
| PubChem CID | 126476891 |
| Molecular Formula | C20H24Cl2N2O3 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [4-[3-(3-chlorophenoxy)-2-hydroxypropyl]piperazin-1-yl]-phenylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1ccccc1)N1CCN(CC(O)COc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H23ClN2O3.ClH/c21-17-7-4-8-19(13-17)26-15-18(24)14-22-9-11-23(12-10-22)20(25)16-5-2-1-3-6-16;/h1-8,13,18,24H,9-12,14-15H2;1H |
| InChIKey | VLMVKUPVRQMNLP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |