C23H27N3O9S — CID 126477298
N-[4-[4-[2-(4-methylphenoxy)acetyl]piperazin-1-yl]sulfonylphenyl]acetamide;oxalic acid (PubChem CID 126477298) has the molecular formula C23H27N3O9S and a molecular weight of 521.55 g/mol. Its IUPAC name is N-[4-[4-[2-(4-methylphenoxy)acetyl]piperazin-1-yl]sulfonylphenyl]acetamide;oxalic acid.
| Compound Name | N-[4-[4-[2-(4-methylphenoxy)acetyl]piperazin-1-yl]sulfonylphenyl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 126477298 |
| Molecular Formula | C23H27N3O9S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | N-[4-[4-[2-(4-methylphenoxy)acetyl]piperazin-1-yl]sulfonylphenyl]acetamide;oxalic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCN(C(=O)COc3ccc(C)cc3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H25N3O5S.C2H2O4/c1-16-3-7-19(8-4-16)29-15-21(26)23-11-13-24(14-12-23)30(27,28)20-9-5-18(6-10-20)22-17(2)25;3-1(4)2(5)6/h3-10H,11-15H2,1-2H3,(H,22,25);(H,3,4)(H,5,6) |
| InChIKey | HZLRGMQJXCSEOQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|