C29H33NO9 — CID 126477718
2-(1,3-benzodioxol-5-yl)-N-[(3,5-dimethoxyphenyl)methyl]-N-[(4-ethoxyphenyl)methyl]ethanamine;oxalic acid (PubChem CID 126477718) has the molecular formula C29H33NO9 and a molecular weight of 539.58 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(3,5-dimethoxyphenyl)methyl]-N-[(4-ethoxyphenyl)methyl]ethanamine;oxalic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(3,5-dimethoxyphenyl)methyl]-N-[(4-ethoxyphenyl)methyl]ethanamine;oxalic acid |
|---|---|
| PubChem CID | 126477718 |
| Molecular Formula | C29H33NO9 |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(3,5-dimethoxyphenyl)methyl]-N-[(4-ethoxyphenyl)methyl]ethanamine;oxalic acid |
| SMILES | CCOc1ccc(CN(CCc2ccc3c(c2)OCO3)Cc2cc(OC)cc(OC)c2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H31NO5.C2H2O4/c1-4-31-23-8-5-21(6-9-23)17-28(18-22-13-24(29-2)16-25(14-22)30-3)12-11-20-7-10-26-27(15-20)33-19-32-26;3-1(4)2(5)6/h5-10,13-16H,4,11-12,17-19H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | UPLSMONINWEOEB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|