C27H28FNO7 — CID 163327826
2-(1,3-benzodioxol-5-yl)-N-[(4-ethoxyphenyl)methyl]-N-[(2-fluorophenyl)methyl]ethanamine;oxalic acid (PubChem CID 163327826) has the molecular formula C27H28FNO7 and a molecular weight of 497.52 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(4-ethoxyphenyl)methyl]-N-[(2-fluorophenyl)methyl]ethanamine;oxalic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(4-ethoxyphenyl)methyl]-N-[(2-fluorophenyl)methyl]ethanamine;oxalic acid |
|---|---|
| PubChem CID | 163327826 |
| Molecular Formula | C27H28FNO7 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(4-ethoxyphenyl)methyl]-N-[(2-fluorophenyl)methyl]ethanamine;oxalic acid |
| SMILES | CCOc1ccc(CN(CCc2ccc3c(c2)OCO3)Cc2ccccc2F)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H26FNO3.C2H2O4/c1-2-28-22-10-7-20(8-11-22)16-27(17-21-5-3-4-6-23(21)26)14-13-19-9-12-24-25(15-19)30-18-29-24;3-1(4)2(5)6/h3-12,15H,2,13-14,16-18H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | XCEBBQURHLJRIG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|