C18H19Br2N3O2 — CID 126478002
4-bromo-N-[6-[(5-bromo-2-pyridinyl)amino]-6-oxohexyl]benzamide (PubChem CID 126478002) has the molecular formula C18H19Br2N3O2 and a molecular weight of 469.18 g/mol. Its IUPAC name is 4-bromo-N-[6-[(5-bromo-2-pyridinyl)amino]-6-oxohexyl]benzamide.
| Compound Name | 4-bromo-N-[6-[(5-bromo-2-pyridinyl)amino]-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 126478002 |
| Molecular Formula | C18H19Br2N3O2 |
| Molecular Weight | 469.18 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | 4-bromo-N-[6-[(5-bromo-2-pyridinyl)amino]-6-oxohexyl]benzamide |
| SMILES | O=C(CCCCCNC(=O)c1ccc(Br)cc1)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C18H19Br2N3O2/c19-14-7-5-13(6-8-14)18(25)21-11-3-1-2-4-17(24)23-16-10-9-15(20)12-22-16/h5-10,12H,1-4,11H2,(H,21,25)(H,22,23,24) |
| InChIKey | CSGWAZQKUSUPRD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.18 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|