C16H24BrN3O2 — CID 119741967
N-[2-(7-aminoheptanoylamino)ethyl]-4-bromobenzamide (PubChem CID 119741967) has the molecular formula C16H24BrN3O2 and a molecular weight of 370.29 g/mol. Its IUPAC name is N-[2-(7-aminoheptanoylamino)ethyl]-4-bromobenzamide.
| Compound Name | N-[2-(7-aminoheptanoylamino)ethyl]-4-bromobenzamide |
|---|---|
| PubChem CID | 119741967 |
| Molecular Formula | C16H24BrN3O2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-[2-(7-aminoheptanoylamino)ethyl]-4-bromobenzamide |
| SMILES | NCCCCCCC(=O)NCCNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H24BrN3O2/c17-14-8-6-13(7-9-14)16(22)20-12-11-19-15(21)5-3-1-2-4-10-18/h6-9H,1-5,10-12,18H2,(H,19,21)(H,20,22) |
| InChIKey | VPKXZHDPIWAQEF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|