C15H22BrFN2O — CID 119745593
7-amino-N-[2-(5-bromo-2-fluorophenyl)ethyl]heptanamide (PubChem CID 119745593) has the molecular formula C15H22BrFN2O and a molecular weight of 345.26 g/mol. Its IUPAC name is 7-amino-N-[2-(5-bromo-2-fluorophenyl)ethyl]heptanamide.
| Compound Name | 7-amino-N-[2-(5-bromo-2-fluorophenyl)ethyl]heptanamide |
|---|---|
| PubChem CID | 119745593 |
| Molecular Formula | C15H22BrFN2O |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 7-amino-N-[2-(5-bromo-2-fluorophenyl)ethyl]heptanamide |
| SMILES | NCCCCCCC(=O)NCCc1cc(Br)ccc1F |
| InChI | InChI=1S/C15H22BrFN2O/c16-13-6-7-14(17)12(11-13)8-10-19-15(20)5-3-1-2-4-9-18/h6-7,11H,1-5,8-10,18H2,(H,19,20) |
| InChIKey | VSROGUXFLVNUOL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|