C11H13BrFNO2 — CID 110792453
ethyl N-[2-(5-bromo-2-fluorophenyl)ethyl]carbamate (PubChem CID 110792453) has the molecular formula C11H13BrFNO2 and a molecular weight of 290.13 g/mol. Its IUPAC name is ethyl N-[2-(5-bromo-2-fluorophenyl)ethyl]carbamate.
| Compound Name | ethyl N-[2-(5-bromo-2-fluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 110792453 |
| Molecular Formula | C11H13BrFNO2 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | ethyl N-[2-(5-bromo-2-fluorophenyl)ethyl]carbamate |
| SMILES | CCOC(=O)NCCc1cc(Br)ccc1F |
| InChI | InChI=1S/C11H13BrFNO2/c1-2-16-11(15)14-6-5-8-7-9(12)3-4-10(8)13/h3-4,7H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | QZICHQVANHRQKZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |