C17H17BrFNO2 — CID 95153820
(2R)-N-[2-(5-bromo-2-fluorophenyl)ethyl]-2-methoxy-2-phenylacetamide (PubChem CID 95153820) has the molecular formula C17H17BrFNO2 and a molecular weight of 366.23 g/mol. Its IUPAC name is (2R)-N-[2-(5-bromo-2-fluorophenyl)ethyl]-2-methoxy-2-phenylacetamide.
| Compound Name | (2R)-N-[2-(5-bromo-2-fluorophenyl)ethyl]-2-methoxy-2-phenylacetamide |
|---|---|
| PubChem CID | 95153820 |
| Molecular Formula | C17H17BrFNO2 |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | (2R)-N-[2-(5-bromo-2-fluorophenyl)ethyl]-2-methoxy-2-phenylacetamide |
| SMILES | CO[C@@H](C(=O)NCCc1cc(Br)ccc1F)c1ccccc1 |
| InChI | InChI=1S/C17H17BrFNO2/c1-22-16(12-5-3-2-4-6-12)17(21)20-10-9-13-11-14(18)7-8-15(13)19/h2-8,11,16H,9-10H2,1H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | HXCIZOYVGGFRQY-MRXNPFEDSA-N |
| XLogP | 3.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |