C20H31N5O5S2 — CID 126478860
N-[3-(diethylamino)propyl]-2-(6-methyl-5-morpholin-4-ylsulfonyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 126478860) has the molecular formula C20H31N5O5S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-(6-methyl-5-morpholin-4-ylsulfonyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[3-(diethylamino)propyl]-2-(6-methyl-5-morpholin-4-ylsulfonyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 126478860 |
| Molecular Formula | C20H31N5O5S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-(6-methyl-5-morpholin-4-ylsulfonyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | CCN(CC)CCCNC(=O)Cn1cnc2sc(C)c(S(=O)(=O)N3CCOCC3)c2c1=O |
| InChI | InChI=1S/C20H31N5O5S2/c1-4-23(5-2)8-6-7-21-16(26)13-24-14-22-19-17(20(24)27)18(15(3)31-19)32(28,29)25-9-11-30-12-10-25/h14H,4-13H2,1-3H3,(H,21,26) |
| InChIKey | OXUTXODTQUHBFD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|