C19H28N4O4S2 — CID 4137612
N-butyl-2-[6-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetamide (PubChem CID 4137612) has the molecular formula C19H28N4O4S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-butyl-2-[6-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetamide.
| Compound Name | N-butyl-2-[6-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetamide |
|---|---|
| PubChem CID | 4137612 |
| Molecular Formula | C19H28N4O4S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-butyl-2-[6-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetamide |
| SMILES | CCCCNC(=O)Cn1cnc2sc(C)c(S(=O)(=O)N3CCC(C)CC3)c2c1=O |
| InChI | InChI=1S/C19H28N4O4S2/c1-4-5-8-20-15(24)11-22-12-21-18-16(19(22)25)17(14(3)28-18)29(26,27)23-9-6-13(2)7-10-23/h12-13H,4-11H2,1-3H3,(H,20,24) |
| InChIKey | MRDOYSMMGQGWCL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|