C23H28N4O4S — CID 126479780
N-(3-methoxypropyl)-5-methyl-4-oxo-3-[2-oxo-2-(4-propan-2-ylanilino)ethyl]thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 126479780) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-(3-methoxypropyl)-5-methyl-4-oxo-3-[2-oxo-2-(4-propan-2-ylanilino)ethyl]thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-(3-methoxypropyl)-5-methyl-4-oxo-3-[2-oxo-2-(4-propan-2-ylanilino)ethyl]thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126479780 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-(3-methoxypropyl)-5-methyl-4-oxo-3-[2-oxo-2-(4-propan-2-ylanilino)ethyl]thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COCCCNC(=O)c1sc2ncn(CC(=O)Nc3ccc(C(C)C)cc3)c(=O)c2c1C |
| InChI | InChI=1S/C23H28N4O4S/c1-14(2)16-6-8-17(9-7-16)26-18(28)12-27-13-25-22-19(23(27)30)15(3)20(32-22)21(29)24-10-5-11-31-4/h6-9,13-14H,5,10-12H2,1-4H3,(H,24,29)(H,26,28) |
| InChIKey | VSQZXOZUSIWIAS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|