C23H28N4O3S — CID 22333946
4-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-N-(4-propan-2-ylphenyl)butanamide (PubChem CID 22333946) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 4-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-N-(4-propan-2-ylphenyl)butanamide.
| Compound Name | 4-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-N-(4-propan-2-ylphenyl)butanamide |
|---|---|
| PubChem CID | 22333946 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 4-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-N-(4-propan-2-ylphenyl)butanamide |
| SMILES | Cc1sc2ncn(CC(=O)NCCCC(=O)Nc3ccc(C(C)C)cc3)c(=O)c2c1C |
| InChI | InChI=1S/C23H28N4O3S/c1-14(2)17-7-9-18(10-8-17)26-19(28)6-5-11-24-20(29)12-27-13-25-22-21(23(27)30)15(3)16(4)31-22/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,24,29)(H,26,28) |
| InChIKey | XFNMTAXIKOSPSM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|