C21H21F3N4O3S — CID 126478726
4-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 126478726) has the molecular formula C21H21F3N4O3S and a molecular weight of 466.49 g/mol. Its IUPAC name is 4-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 126478726 |
| Molecular Formula | C21H21F3N4O3S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 4-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | Cc1sc2ncn(CC(=O)NCCCC(=O)Nc3cccc(C(F)(F)F)c3)c(=O)c2c1C |
| InChI | InChI=1S/C21H21F3N4O3S/c1-12-13(2)32-19-18(12)20(31)28(11-26-19)10-17(30)25-8-4-7-16(29)27-15-6-3-5-14(9-15)21(22,23)24/h3,5-6,9,11H,4,7-8,10H2,1-2H3,(H,25,30)(H,27,29) |
| InChIKey | LYZFFAPZYSJPQW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|