C26H26N4O4S — CID 22333912
4-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-N-(4-phenoxyphenyl)butanamide (PubChem CID 22333912) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is 4-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-N-(4-phenoxyphenyl)butanamide.
| Compound Name | 4-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-N-(4-phenoxyphenyl)butanamide |
|---|---|
| PubChem CID | 22333912 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 4-[[2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]-N-(4-phenoxyphenyl)butanamide |
| SMILES | Cc1sc2ncn(CC(=O)NCCCC(=O)Nc3ccc(Oc4ccccc4)cc3)c(=O)c2c1C |
| InChI | InChI=1S/C26H26N4O4S/c1-17-18(2)35-25-24(17)26(33)30(16-28-25)15-23(32)27-14-6-9-22(31)29-19-10-12-21(13-11-19)34-20-7-4-3-5-8-20/h3-5,7-8,10-13,16H,6,9,14-15H2,1-2H3,(H,27,32)(H,29,31) |
| InChIKey | IVQXAXPGHVMICZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|