C22H27N3O3S — CID 46536850
3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-[3-(1-phenylethoxy)propyl]propanamide (PubChem CID 46536850) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-[3-(1-phenylethoxy)propyl]propanamide.
| Compound Name | 3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-[3-(1-phenylethoxy)propyl]propanamide |
|---|---|
| PubChem CID | 46536850 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-[3-(1-phenylethoxy)propyl]propanamide |
| SMILES | Cc1sc2ncn(CCC(=O)NCCCOC(C)c3ccccc3)c(=O)c2c1C |
| InChI | InChI=1S/C22H27N3O3S/c1-15-17(3)29-21-20(15)22(27)25(14-24-21)12-10-19(26)23-11-7-13-28-16(2)18-8-5-4-6-9-18/h4-6,8-9,14,16H,7,10-13H2,1-3H3,(H,23,26) |
| InChIKey | NGCMGPOJNMWSPL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|