C25H33N5O2S — CID 55634026
N-[3-(4-benzylpiperazin-1-yl)propyl]-3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide (PubChem CID 55634026) has the molecular formula C25H33N5O2S and a molecular weight of 467.64 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide |
|---|---|
| PubChem CID | 55634026 |
| Molecular Formula | C25H33N5O2S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide |
| SMILES | Cc1sc2ncn(CCC(=O)NCCCN3CCN(Cc4ccccc4)CC3)c(=O)c2c1C |
| InChI | InChI=1S/C25H33N5O2S/c1-19-20(2)33-24-23(19)25(32)30(18-27-24)12-9-22(31)26-10-6-11-28-13-15-29(16-14-28)17-21-7-4-3-5-8-21/h3-5,7-8,18H,6,9-17H2,1-2H3,(H,26,31) |
| InChIKey | WUJVCZNMRJOFAY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|