C22H19N5O2S — CID 7629831
2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-(4-phenyldiazenylphenyl)acetamide (PubChem CID 7629831) has the molecular formula C22H19N5O2S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-(4-phenyldiazenylphenyl)acetamide.
| Compound Name | 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-(4-phenyldiazenylphenyl)acetamide |
|---|---|
| PubChem CID | 7629831 |
| Molecular Formula | C22H19N5O2S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-(4-phenyldiazenylphenyl)acetamide |
| SMILES | Cc1sc2ncn(CC(=O)Nc3ccc(/N=N/c4ccccc4)cc3)c(=O)c2c1C |
| InChI | InChI=1S/C22H19N5O2S/c1-14-15(2)30-21-20(14)22(29)27(13-23-21)12-19(28)24-16-8-10-18(11-9-16)26-25-17-6-4-3-5-7-17/h3-11,13H,12H2,1-2H3,(H,24,28)/b26-25+ |
| InChIKey | XMZBWGGWHBYEOG-OCEACIFDSA-N |
| XLogP | 5.13 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|