C42H60N6O5 — CID 126480584
2-[2,5-bis[4-(2-pyrrolidin-1-ylethyl)piperidine-1-carbonyl]anilino]-5-(pyrrolidin-1-ylmethoxy)benzoic acid (PubChem CID 126480584) has the molecular formula C42H60N6O5 and a molecular weight of 728.98 g/mol. Its IUPAC name is 2-[2,5-bis[4-(2-pyrrolidin-1-ylethyl)piperidine-1-carbonyl]anilino]-5-(pyrrolidin-1-ylmethoxy)benzoic acid.
| Compound Name | 2-[2,5-bis[4-(2-pyrrolidin-1-ylethyl)piperidine-1-carbonyl]anilino]-5-(pyrrolidin-1-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 126480584 |
| Molecular Formula | C42H60N6O5 |
| Molecular Weight | 728.98 g/mol |
| Exact Mass | 728.46 |
| IUPAC Name | 2-[2,5-bis[4-(2-pyrrolidin-1-ylethyl)piperidine-1-carbonyl]anilino]-5-(pyrrolidin-1-ylmethoxy)benzoic acid |
| SMILES | O=C(O)c1cc(OCN2CCCC2)ccc1Nc1cc(C(=O)N2CCC(CCN3CCCC3)CC2)ccc1C(=O)N1CCC(CCN2CCCC2)CC1 |
| InChI | InChI=1S/C42H60N6O5/c49-40(47-25-13-32(14-26-47)11-23-44-17-1-2-18-44)34-7-9-36(41(50)48-27-15-33(16-28-48)12-24-45-19-3-4-20-45)39(29-34)43-38-10-8-35(30-37(38)42(51)52)53-31-46-21-5-6-22-46/h7-10,29-30,32-33,43H,1-6,11-28,31H2,(H,51,52) |
| InChIKey | ZKAPTZUXASXLDR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.98 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_acid_G(1)', 'substructure': 'N/A'} |
|---|