C11H13F2IO2 — CID 126481939
1-(2-ethoxy-2,2-difluoro-1-iodoethyl)-4-methoxybenzene (PubChem CID 126481939) has the molecular formula C11H13F2IO2 and a molecular weight of 342.12 g/mol. Its IUPAC name is 1-(2-ethoxy-2,2-difluoro-1-iodoethyl)-4-methoxybenzene.
| Compound Name | 1-(2-ethoxy-2,2-difluoro-1-iodoethyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 126481939 |
| Molecular Formula | C11H13F2IO2 |
| Molecular Weight | 342.12 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 1-(2-ethoxy-2,2-difluoro-1-iodoethyl)-4-methoxybenzene |
| SMILES | CCOC(F)(F)C(I)c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H13F2IO2/c1-3-16-11(12,13)10(14)8-4-6-9(15-2)7-5-8/h4-7,10H,3H2,1-2H3 |
| InChIKey | ASRHESNTLCKGFE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.12 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|