C32H28FN7O — CID 126485188
4-[[4-(benzhydrylideneamino)-1-methylimidazo[4,5-c]pyridin-6-yl]-methylamino]-N-(cyanomethyl)-3-ethyl-5-fluorobenzamide (PubChem CID 126485188) has the molecular formula C32H28FN7O and a molecular weight of 545.62 g/mol. Its IUPAC name is 4-[[4-(benzhydrylideneamino)-1-methylimidazo[4,5-c]pyridin-6-yl]-methylamino]-N-(cyanomethyl)-3-ethyl-5-fluorobenzamide.
| Compound Name | 4-[[4-(benzhydrylideneamino)-1-methylimidazo[4,5-c]pyridin-6-yl]-methylamino]-N-(cyanomethyl)-3-ethyl-5-fluorobenzamide |
|---|---|
| PubChem CID | 126485188 |
| Molecular Formula | C32H28FN7O |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 4-[[4-(benzhydrylideneamino)-1-methylimidazo[4,5-c]pyridin-6-yl]-methylamino]-N-(cyanomethyl)-3-ethyl-5-fluorobenzamide |
| SMILES | CCc1cc(C(=O)NCC#N)cc(F)c1N(C)c1cc2c(ncn2C)c(N=C(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C32H28FN7O/c1-4-21-17-24(32(41)35-16-15-34)18-25(33)30(21)40(3)27-19-26-29(36-20-39(26)2)31(37-27)38-28(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-14,17-20H,4,16H2,1-3H3,(H,35,41) |
| InChIKey | DLXKEJDHYGDNOL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|