C8H8FN3 — CID 126485209
4-amino-5-ethyl-3-fluoropyridine-2-carbonitrile (PubChem CID 126485209) has the molecular formula C8H8FN3 and a molecular weight of 165.17 g/mol. Its IUPAC name is 4-amino-5-ethyl-3-fluoropyridine-2-carbonitrile.
| Compound Name | 4-amino-5-ethyl-3-fluoropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 126485209 |
| Molecular Formula | C8H8FN3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 4-amino-5-ethyl-3-fluoropyridine-2-carbonitrile |
| SMILES | CCc1cnc(C#N)c(F)c1N |
| InChI | InChI=1S/C8H8FN3/c1-2-5-4-12-6(3-10)7(9)8(5)11/h4H,2H2,1H3,(H2,11,12) |
| InChIKey | JWZKKSVEIUWUKJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |