C20H35N — CID 126485607
(2R,6S)-2-[(E)-2-[(1R,2R,4aR,8aS)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]ethenyl]-1,6-dimethylpiperidine (PubChem CID 126485607) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is (2R,6S)-2-[(E)-2-[(1R,2R,4aR,8aS)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]ethenyl]-1,6-dimethylpiperidine.
| Compound Name | (2R,6S)-2-[(E)-2-[(1R,2R,4aR,8aS)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]ethenyl]-1,6-dimethylpiperidine |
|---|---|
| PubChem CID | 126485607 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | (2R,6S)-2-[(E)-2-[(1R,2R,4aR,8aS)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]ethenyl]-1,6-dimethylpiperidine |
| SMILES | C[C@@H]1CC[C@H]2CCCC[C@@H]2[C@H]1/C=C/[C@H]1CCC[C@H](C)N1C |
| InChI | InChI=1S/C20H35N/c1-15-11-12-17-8-4-5-10-20(17)19(15)14-13-18-9-6-7-16(2)21(18)3/h13-20H,4-12H2,1-3H3/b14-13+/t15-,16+,17-,18-,19+,20+/m1/s1 |
| InChIKey | PQJNLWDTNRPPMB-FACAZMFYSA-N |
| XLogP | 5.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|