C11H16O3 — CID 12648691
1-(3,4-dihydro-2H-pyran-2-yl)hexane-1,4-dione (PubChem CID 12648691) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-2-yl)hexane-1,4-dione.
| Compound Name | 1-(3,4-dihydro-2H-pyran-2-yl)hexane-1,4-dione |
|---|---|
| PubChem CID | 12648691 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-2-yl)hexane-1,4-dione |
| SMILES | CCC(=O)CCC(=O)C1CCC=CO1 |
| InChI | InChI=1S/C11H16O3/c1-2-9(12)6-7-10(13)11-5-3-4-8-14-11/h4,8,11H,2-3,5-7H2,1H3 |
| InChIKey | UAUAKTNDJRJYOU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |