C13H15O2PS4 — CID 126487753
4-ethynyl-6-[2-(2-methoxy-2-oxo-1,3,2λ5-dithiaphosphinan-4-yl)ethynyl]thiane-2-thione (PubChem CID 126487753) has the molecular formula C13H15O2PS4 and a molecular weight of 362.50 g/mol. Its IUPAC name is 4-ethynyl-6-[2-(2-methoxy-2-oxo-1,3,2λ5-dithiaphosphinan-4-yl)ethynyl]thiane-2-thione.
| Compound Name | 4-ethynyl-6-[2-(2-methoxy-2-oxo-1,3,2λ5-dithiaphosphinan-4-yl)ethynyl]thiane-2-thione |
|---|---|
| PubChem CID | 126487753 |
| Molecular Formula | C13H15O2PS4 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 4-ethynyl-6-[2-(2-methoxy-2-oxo-1,3,2λ5-dithiaphosphinan-4-yl)ethynyl]thiane-2-thione |
| SMILES | C#CC1CC(=S)SC(C#CC2CCSP(=O)(OC)S2)C1 |
| InChI | InChI=1S/C13H15O2PS4/c1-3-10-8-12(19-13(17)9-10)5-4-11-6-7-18-16(14,15-2)20-11/h1,10-12H,6-9H2,2H3 |
| InChIKey | BNEXIGFFKKFXKX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|