C13H14N2O3 — CID 168500900
1-(2,6-dimethoxy-3-pyridinyl)-4-ethynylpyrrolidin-2-one (PubChem CID 168500900) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-(2,6-dimethoxy-3-pyridinyl)-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-(2,6-dimethoxy-3-pyridinyl)-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168500900 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-(2,6-dimethoxy-3-pyridinyl)-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2ccc(OC)nc2OC)C1 |
| InChI | InChI=1S/C13H14N2O3/c1-4-9-7-12(16)15(8-9)10-5-6-11(17-2)14-13(10)18-3/h1,5-6,9H,7-8H2,2-3H3 |
| InChIKey | MECJRXAVYUJCPJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|