C21H24N2O — CID 126488738
N-methyl-1-[4-[[(1S,2S)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]methanimine (PubChem CID 126488738) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is N-methyl-1-[4-[[(1S,2S)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]methanimine.
| Compound Name | N-methyl-1-[4-[[(1S,2S)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]methanimine |
|---|---|
| PubChem CID | 126488738 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-methyl-1-[4-[[(1S,2S)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]methanimine |
| SMILES | C/N=C/c1ccc(O[C@H]2c3ccccc3C[C@@H]2N2CCCC2)cc1 |
| InChI | InChI=1S/C21H24N2O/c1-22-15-16-8-10-18(11-9-16)24-21-19-7-3-2-6-17(19)14-20(21)23-12-4-5-13-23/h2-3,6-11,15,20-21H,4-5,12-14H2,1H3/b22-15+/t20-,21-/m0/s1 |
| InChIKey | GJNXKEHGXNKGMF-PPGLHRCHSA-N |
| XLogP | 3.88 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|