C21H25N3O2 — CID 76775087
3-[[2-(3-aminopiperidin-1-yl)-2,3-dihydro-1H-inden-1-yl]oxy]benzamide (PubChem CID 76775087) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-[[2-(3-aminopiperidin-1-yl)-2,3-dihydro-1H-inden-1-yl]oxy]benzamide.
| Compound Name | 3-[[2-(3-aminopiperidin-1-yl)-2,3-dihydro-1H-inden-1-yl]oxy]benzamide |
|---|---|
| PubChem CID | 76775087 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 3-[[2-(3-aminopiperidin-1-yl)-2,3-dihydro-1H-inden-1-yl]oxy]benzamide |
| SMILES | NC(=O)c1cccc(OC2c3ccccc3CC2N2CCCC(N)C2)c1 |
| InChI | InChI=1S/C21H25N3O2/c22-16-7-4-10-24(13-16)19-12-14-5-1-2-9-18(14)20(19)26-17-8-3-6-15(11-17)21(23)25/h1-3,5-6,8-9,11,16,19-20H,4,7,10,12-13,22H2,(H2,23,25) |
| InChIKey | BWTJCWGZFGDCLV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |