C22H26ClN3O2 — CID 58393446
2-[[(1S,2S)-2-[(3S)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-5-chlorobenzamide (PubChem CID 58393446) has the molecular formula C22H26ClN3O2 and a molecular weight of 399.92 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-[(3S)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-5-chlorobenzamide.
| Compound Name | 2-[[(1S,2S)-2-[(3S)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-5-chlorobenzamide |
|---|---|
| PubChem CID | 58393446 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-[[(1S,2S)-2-[(3S)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-5-chlorobenzamide |
| SMILES | NC(=O)c1cc(Cl)ccc1O[C@H]1c2ccccc2CC[C@@H]1N1CCC[C@H](N)C1 |
| InChI | InChI=1S/C22H26ClN3O2/c23-15-8-10-20(18(12-15)22(25)27)28-21-17-6-2-1-4-14(17)7-9-19(21)26-11-3-5-16(24)13-26/h1-2,4,6,8,10,12,16,19,21H,3,5,7,9,11,13,24H2,(H2,25,27)/t16-,19-,21-/m0/s1 |
| InChIKey | CWACGMRUVXXWOK-LRQRDZAKSA-N |
| XLogP | 3.30 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |