C24H29N3O — CID 58393944
4-[[(1S,2S)-2-[(3R)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-3,5-dimethylbenzonitrile (PubChem CID 58393944) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-[(3R)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-3,5-dimethylbenzonitrile.
| Compound Name | 4-[[(1S,2S)-2-[(3R)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 58393944 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 4-[[(1S,2S)-2-[(3R)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1O[C@H]1c2ccccc2CC[C@@H]1N1CCC[C@@H](N)C1 |
| InChI | InChI=1S/C24H29N3O/c1-16-12-18(14-25)13-17(2)23(16)28-24-21-8-4-3-6-19(21)9-10-22(24)27-11-5-7-20(26)15-27/h3-4,6,8,12-13,20,22,24H,5,7,9-11,15,26H2,1-2H3/t20-,22+,24+/m1/s1 |
| InChIKey | GDXHJYVBHIVGBF-SFLYRZDNSA-N |
| XLogP | 4.03 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |