C23H27N5O — CID 67310335
(3S)-1-[1-[4-(1,2,4-triazol-1-yl)phenoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-3-amine (PubChem CID 67310335) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is (3S)-1-[1-[4-(1,2,4-triazol-1-yl)phenoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-3-amine.
| Compound Name | (3S)-1-[1-[4-(1,2,4-triazol-1-yl)phenoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 67310335 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (3S)-1-[1-[4-(1,2,4-triazol-1-yl)phenoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-3-amine |
| SMILES | N[C@H]1CCCN(C2CCc3ccccc3C2Oc2ccc(-n3cncn3)cc2)C1 |
| InChI | InChI=1S/C23H27N5O/c24-18-5-3-13-27(14-18)22-12-7-17-4-1-2-6-21(17)23(22)29-20-10-8-19(9-11-20)28-16-25-15-26-28/h1-2,4,6,8-11,15-16,18,22-23H,3,5,7,12-14,24H2/t18-,22?,23?/m0/s1 |
| InChIKey | VXDFDOWWVJHGFI-NWLLBJEDSA-N |
| XLogP | 3.13 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |