C22H24N2O3S — CID 58393825
5-[[(1S,2S)-2-[(3S)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-1,3-benzoxathiol-2-one (PubChem CID 58393825) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 5-[[(1S,2S)-2-[(3S)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-1,3-benzoxathiol-2-one.
| Compound Name | 5-[[(1S,2S)-2-[(3S)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 58393825 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 5-[[(1S,2S)-2-[(3S)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-1,3-benzoxathiol-2-one |
| SMILES | N[C@H]1CCCN([C@H]2CCc3ccccc3[C@@H]2Oc2ccc3oc(=O)sc3c2)C1 |
| InChI | InChI=1S/C22H24N2O3S/c23-15-5-3-11-24(13-15)18-9-7-14-4-1-2-6-17(14)21(18)26-16-8-10-19-20(12-16)28-22(25)27-19/h1-2,4,6,8,10,12,15,18,21H,3,5,7,9,11,13,23H2/t15-,18-,21-/m0/s1 |
| InChIKey | ZANOQXBEQLUORL-XERREHJYSA-N |
| XLogP | 3.71 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|