C24H26ClN3O — CID 58393636
(3R)-1-[(1S,2S)-1-(2-chloroquinolin-8-yl)oxy-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-3-amine (PubChem CID 58393636) has the molecular formula C24H26ClN3O and a molecular weight of 407.95 g/mol. Its IUPAC name is (3R)-1-[(1S,2S)-1-(2-chloroquinolin-8-yl)oxy-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-3-amine.
| Compound Name | (3R)-1-[(1S,2S)-1-(2-chloroquinolin-8-yl)oxy-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 58393636 |
| Molecular Formula | C24H26ClN3O |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (3R)-1-[(1S,2S)-1-(2-chloroquinolin-8-yl)oxy-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-3-amine |
| SMILES | N[C@@H]1CCCN([C@H]2CCc3ccccc3[C@@H]2Oc2cccc3ccc(Cl)nc23)C1 |
| InChI | InChI=1S/C24H26ClN3O/c25-22-13-11-17-6-3-9-21(23(17)27-22)29-24-19-8-2-1-5-16(19)10-12-20(24)28-14-4-7-18(26)15-28/h1-3,5-6,8-9,11,13,18,20,24H,4,7,10,12,14-15,26H2/t18-,20+,24+/m1/s1 |
| InChIKey | GPQHELMRJNRTKF-WWEVIYMKSA-N |
| XLogP | 4.75 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|