C11H19NO — CID 126489255
1-[2-[(3E)-penta-1,3-dien-3-yl]oxyethyl]pyrrolidine (PubChem CID 126489255) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-[2-[(3E)-penta-1,3-dien-3-yl]oxyethyl]pyrrolidine.
| Compound Name | 1-[2-[(3E)-penta-1,3-dien-3-yl]oxyethyl]pyrrolidine |
|---|---|
| PubChem CID | 126489255 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-[2-[(3E)-penta-1,3-dien-3-yl]oxyethyl]pyrrolidine |
| SMILES | C=C/C(=C\C)OCCN1CCCC1 |
| InChI | InChI=1S/C11H19NO/c1-3-11(4-2)13-10-9-12-7-5-6-8-12/h3-4H,1,5-10H2,2H3/b11-4+ |
| InChIKey | ZEDLMNJXIQZJEQ-NYYWCZLTSA-N |
| XLogP | 2.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|