C14H25NO6S — CID 126491791
1-O-[3-(2-methylpropylsulfonylamino)propyl] 4-O-propan-2-yl (E)-but-2-enedioate (PubChem CID 126491791) has the molecular formula C14H25NO6S and a molecular weight of 335.42 g/mol. Its IUPAC name is 1-O-[3-(2-methylpropylsulfonylamino)propyl] 4-O-propan-2-yl (E)-but-2-enedioate.
| Compound Name | 1-O-[3-(2-methylpropylsulfonylamino)propyl] 4-O-propan-2-yl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126491791 |
| Molecular Formula | C14H25NO6S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-O-[3-(2-methylpropylsulfonylamino)propyl] 4-O-propan-2-yl (E)-but-2-enedioate |
| SMILES | CC(C)CS(=O)(=O)NCCCOC(=O)/C=C/C(=O)OC(C)C |
| InChI | InChI=1S/C14H25NO6S/c1-11(2)10-22(18,19)15-8-5-9-20-13(16)6-7-14(17)21-12(3)4/h6-7,11-12,15H,5,8-10H2,1-4H3/b7-6+ |
| InChIKey | MBYZCKIUPMTLQI-VOTSOKGWSA-N |
| XLogP | 1.00 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|