C8H17NO5S — CID 79457640
2-[2-(2-methylpropylsulfonylamino)ethoxy]acetic acid (PubChem CID 79457640) has the molecular formula C8H17NO5S and a molecular weight of 239.29 g/mol. Its IUPAC name is 2-[2-(2-methylpropylsulfonylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-(2-methylpropylsulfonylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 79457640 |
| Molecular Formula | C8H17NO5S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-[2-(2-methylpropylsulfonylamino)ethoxy]acetic acid |
| SMILES | CC(C)CS(=O)(=O)NCCOCC(=O)O |
| InChI | InChI=1S/C8H17NO5S/c1-7(2)6-15(12,13)9-3-4-14-5-8(10)11/h7,9H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | LTRKQFKIEDQUBI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|